C20H20N8O — CID 59588823
5-(9-benzyl-2-morpholin-4-ylpurin-6-yl)pyrimidin-2-amine (PubChem CID 59588823) has the molecular formula C20H20N8O and a molecular weight of 388.44 g/mol. Its IUPAC name is 5-(9-benzyl-2-morpholin-4-ylpurin-6-yl)pyrimidin-2-amine.
| Compound Name | 5-(9-benzyl-2-morpholin-4-ylpurin-6-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 59588823 |
| Molecular Formula | C20H20N8O |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 5-(9-benzyl-2-morpholin-4-ylpurin-6-yl)pyrimidin-2-amine |
| SMILES | Nc1ncc(-c2nc(N3CCOCC3)nc3c2ncn3Cc2ccccc2)cn1 |
| InChI | InChI=1S/C20H20N8O/c21-19-22-10-15(11-23-19)16-17-18(26-20(25-16)27-6-8-29-9-7-27)28(13-24-17)12-14-4-2-1-3-5-14/h1-5,10-11,13H,6-9,12H2,(H2,21,22,23) |
| InChIKey | MIUQSFBQAVMMJQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 107.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |