C19H26N10O — CID 58285250
5-[2-morpholin-4-yl-9-(2-piperazin-1-ylethyl)purin-6-yl]pyrimidin-2-amine (PubChem CID 58285250) has the molecular formula C19H26N10O and a molecular weight of 410.49 g/mol. Its IUPAC name is 5-[2-morpholin-4-yl-9-(2-piperazin-1-ylethyl)purin-6-yl]pyrimidin-2-amine.
| Compound Name | 5-[2-morpholin-4-yl-9-(2-piperazin-1-ylethyl)purin-6-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 58285250 |
| Molecular Formula | C19H26N10O |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 5-[2-morpholin-4-yl-9-(2-piperazin-1-ylethyl)purin-6-yl]pyrimidin-2-amine |
| SMILES | Nc1ncc(-c2nc(N3CCOCC3)nc3c2ncn3CCN2CCNCC2)cn1 |
| InChI | InChI=1S/C19H26N10O/c20-18-22-11-14(12-23-18)15-16-17(26-19(25-15)28-7-9-30-10-8-28)29(13-24-16)6-5-27-3-1-21-2-4-27/h11-13,21H,1-10H2,(H2,20,22,23) |
| InChIKey | HWIBHVJXJIZPPB-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 123.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |