C23H27F2N9O — CID 58285266
4-[6-[2-(difluoromethyl)benzimidazol-1-yl]-9-(2-piperazin-1-ylethyl)purin-2-yl]morpholine (PubChem CID 58285266) has the molecular formula C23H27F2N9O and a molecular weight of 483.53 g/mol. Its IUPAC name is 4-[6-[2-(difluoromethyl)benzimidazol-1-yl]-9-(2-piperazin-1-ylethyl)purin-2-yl]morpholine.
| Compound Name | 4-[6-[2-(difluoromethyl)benzimidazol-1-yl]-9-(2-piperazin-1-ylethyl)purin-2-yl]morpholine |
|---|---|
| PubChem CID | 58285266 |
| Molecular Formula | C23H27F2N9O |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | 4-[6-[2-(difluoromethyl)benzimidazol-1-yl]-9-(2-piperazin-1-ylethyl)purin-2-yl]morpholine |
| SMILES | FC(F)c1nc2ccccc2n1-c1nc(N2CCOCC2)nc2c1ncn2CCN1CCNCC1 |
| InChI | InChI=1S/C23H27F2N9O/c24-19(25)22-28-16-3-1-2-4-17(16)34(22)21-18-20(29-23(30-21)32-11-13-35-14-12-32)33(15-27-18)10-9-31-7-5-26-6-8-31/h1-4,15,19,26H,5-14H2 |
| InChIKey | OAQRQOZYCICVFD-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |