C21H24N8O — CID 143785492
5-[9-[(3E)-6-methylhepta-1,3,5-trien-4-yl]-2-morpholin-4-ylpurin-6-yl]pyrimidin-2-amine (PubChem CID 143785492) has the molecular formula C21H24N8O and a molecular weight of 404.48 g/mol. Its IUPAC name is 5-[9-[(3E)-6-methylhepta-1,3,5-trien-4-yl]-2-morpholin-4-ylpurin-6-yl]pyrimidin-2-amine.
| Compound Name | 5-[9-[(3E)-6-methylhepta-1,3,5-trien-4-yl]-2-morpholin-4-ylpurin-6-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 143785492 |
| Molecular Formula | C21H24N8O |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 5-[9-[(3E)-6-methylhepta-1,3,5-trien-4-yl]-2-morpholin-4-ylpurin-6-yl]pyrimidin-2-amine |
| SMILES | C=C/C=C(\C=C(C)C)n1cnc2c(-c3cnc(N)nc3)nc(N3CCOCC3)nc21 |
| InChI | InChI=1S/C21H24N8O/c1-4-5-16(10-14(2)3)29-13-25-18-17(15-11-23-20(22)24-12-15)26-21(27-19(18)29)28-6-8-30-9-7-28/h4-5,10-13H,1,6-9H2,2-3H3,(H2,22,23,24)/b16-5+ |
| InChIKey | UKSJONUTYRBFCD-FZSIALSZSA-N |
| XLogP | 2.70 |
| TPSA | 107.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|