C21H22N8O2 — CID 67221249
1-[2-[6-(2-aminopyrimidin-5-yl)-2-morpholin-4-ylpurin-9-yl]phenyl]ethanol (PubChem CID 67221249) has the molecular formula C21H22N8O2 and a molecular weight of 418.46 g/mol. Its IUPAC name is 1-[2-[6-(2-aminopyrimidin-5-yl)-2-morpholin-4-ylpurin-9-yl]phenyl]ethanol.
| Compound Name | 1-[2-[6-(2-aminopyrimidin-5-yl)-2-morpholin-4-ylpurin-9-yl]phenyl]ethanol |
|---|---|
| PubChem CID | 67221249 |
| Molecular Formula | C21H22N8O2 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 1-[2-[6-(2-aminopyrimidin-5-yl)-2-morpholin-4-ylpurin-9-yl]phenyl]ethanol |
| SMILES | CC(O)c1ccccc1-n1cnc2c(-c3cnc(N)nc3)nc(N3CCOCC3)nc21 |
| InChI | InChI=1S/C21H22N8O2/c1-13(30)15-4-2-3-5-16(15)29-12-25-18-17(14-10-23-20(22)24-11-14)26-21(27-19(18)29)28-6-8-31-9-7-28/h2-5,10-13,30H,6-9H2,1H3,(H2,22,23,24) |
| InChIKey | RWWXSBOJVZGYOM-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 128.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |