C20H29N9O — CID 46937823
6-(2-aminopyrimidin-5-yl)-9-butan-2-yl-2-morpholin-4-yl-N-propan-2-ylpurin-8-amine (PubChem CID 46937823) has the molecular formula C20H29N9O and a molecular weight of 411.51 g/mol. Its IUPAC name is 6-(2-aminopyrimidin-5-yl)-9-butan-2-yl-2-morpholin-4-yl-N-propan-2-ylpurin-8-amine.
| Compound Name | 6-(2-aminopyrimidin-5-yl)-9-butan-2-yl-2-morpholin-4-yl-N-propan-2-ylpurin-8-amine |
|---|---|
| PubChem CID | 46937823 |
| Molecular Formula | C20H29N9O |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | 6-(2-aminopyrimidin-5-yl)-9-butan-2-yl-2-morpholin-4-yl-N-propan-2-ylpurin-8-amine |
| SMILES | CCC(C)n1c(NC(C)C)nc2c(-c3cnc(N)nc3)nc(N3CCOCC3)nc21 |
| InChI | InChI=1S/C20H29N9O/c1-5-13(4)29-17-16(26-20(29)24-12(2)3)15(14-10-22-18(21)23-11-14)25-19(27-17)28-6-8-30-9-7-28/h10-13H,5-9H2,1-4H3,(H,24,26)(H2,21,22,23) |
| InChIKey | XTMKDCGSKVUQGJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 119.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |