C19H26N8O — CID 137451940
N-ethyl-5-(8-methyl-2-morpholin-4-yl-9-propan-2-ylpurin-6-yl)pyrimidin-2-amine (PubChem CID 137451940) has the molecular formula C19H26N8O and a molecular weight of 382.47 g/mol. Its IUPAC name is N-ethyl-5-(8-methyl-2-morpholin-4-yl-9-propan-2-ylpurin-6-yl)pyrimidin-2-amine.
| Compound Name | N-ethyl-5-(8-methyl-2-morpholin-4-yl-9-propan-2-ylpurin-6-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 137451940 |
| Molecular Formula | C19H26N8O |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | N-ethyl-5-(8-methyl-2-morpholin-4-yl-9-propan-2-ylpurin-6-yl)pyrimidin-2-amine |
| SMILES | CCNc1ncc(-c2nc(N3CCOCC3)nc3c2nc(C)n3C(C)C)cn1 |
| InChI | InChI=1S/C19H26N8O/c1-5-20-18-21-10-14(11-22-18)15-16-17(27(12(2)3)13(4)23-16)25-19(24-15)26-6-8-28-9-7-26/h10-12H,5-9H2,1-4H3,(H,20,21,22) |
| InChIKey | JPQLTNKPJYBWPS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 93.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |