C21H28N8O2 — CID 46938046
5-(8-cyclopentyloxy-2-morpholin-4-yl-9-propan-2-ylpurin-6-yl)pyrimidin-2-amine (PubChem CID 46938046) has the molecular formula C21H28N8O2 and a molecular weight of 424.51 g/mol. Its IUPAC name is 5-(8-cyclopentyloxy-2-morpholin-4-yl-9-propan-2-ylpurin-6-yl)pyrimidin-2-amine.
| Compound Name | 5-(8-cyclopentyloxy-2-morpholin-4-yl-9-propan-2-ylpurin-6-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 46938046 |
| Molecular Formula | C21H28N8O2 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | 5-(8-cyclopentyloxy-2-morpholin-4-yl-9-propan-2-ylpurin-6-yl)pyrimidin-2-amine |
| SMILES | CC(C)n1c(OC2CCCC2)nc2c(-c3cnc(N)nc3)nc(N3CCOCC3)nc21 |
| InChI | InChI=1S/C21H28N8O2/c1-13(2)29-18-17(26-21(29)31-15-5-3-4-6-15)16(14-11-23-19(22)24-12-14)25-20(27-18)28-7-9-30-10-8-28/h11-13,15H,3-10H2,1-2H3,(H2,22,23,24) |
| InChIKey | SGYUCZCJHZKRPD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 117.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |