C18H22N8O2 — CID 25256167
5-[8-methyl-2-morpholin-4-yl-9-(oxolan-3-yl)purin-6-yl]pyrimidin-2-amine (PubChem CID 25256167) has the molecular formula C18H22N8O2 and a molecular weight of 382.43 g/mol. Its IUPAC name is 5-[8-methyl-2-morpholin-4-yl-9-(oxolan-3-yl)purin-6-yl]pyrimidin-2-amine.
| Compound Name | 5-[8-methyl-2-morpholin-4-yl-9-(oxolan-3-yl)purin-6-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 25256167 |
| Molecular Formula | C18H22N8O2 |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 5-[8-methyl-2-morpholin-4-yl-9-(oxolan-3-yl)purin-6-yl]pyrimidin-2-amine |
| SMILES | Cc1nc2c(-c3cnc(N)nc3)nc(N3CCOCC3)nc2n1C1CCOC1 |
| InChI | InChI=1S/C18H22N8O2/c1-11-22-15-14(12-8-20-17(19)21-9-12)23-18(25-3-6-27-7-4-25)24-16(15)26(11)13-2-5-28-10-13/h8-9,13H,2-7,10H2,1H3,(H2,19,20,21) |
| InChIKey | AKQNUWVZMKIMJA-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 117.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |