C18H20N6O — CID 157045468
4-[6,7-dimethyl-4-(6-methyl-3-pyridinyl)pteridin-2-yl]morpholine (PubChem CID 157045468) has the molecular formula C18H20N6O and a molecular weight of 336.40 g/mol. Its IUPAC name is 4-[6,7-dimethyl-4-(6-methyl-3-pyridinyl)pteridin-2-yl]morpholine.
| Compound Name | 4-[6,7-dimethyl-4-(6-methyl-3-pyridinyl)pteridin-2-yl]morpholine |
|---|---|
| PubChem CID | 157045468 |
| Molecular Formula | C18H20N6O |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 4-[6,7-dimethyl-4-(6-methyl-3-pyridinyl)pteridin-2-yl]morpholine |
| SMILES | Cc1ccc(-c2nc(N3CCOCC3)nc3nc(C)c(C)nc23)cn1 |
| InChI | InChI=1S/C18H20N6O/c1-11-4-5-14(10-19-11)15-16-17(21-13(3)12(2)20-16)23-18(22-15)24-6-8-25-9-7-24/h4-5,10H,6-9H2,1-3H3 |
| InChIKey | GPLZYLAIWPDDCU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 76.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |