C17H18F3N5O — CID 157045730
4-[7-methyl-4-[3-(trifluoromethyl)-1-bicyclo[1.1.1]pentanyl]pteridin-2-yl]morpholine (PubChem CID 157045730) has the molecular formula C17H18F3N5O and a molecular weight of 365.36 g/mol. Its IUPAC name is 4-[7-methyl-4-[3-(trifluoromethyl)-1-bicyclo[1.1.1]pentanyl]pteridin-2-yl]morpholine.
| Compound Name | 4-[7-methyl-4-[3-(trifluoromethyl)-1-bicyclo[1.1.1]pentanyl]pteridin-2-yl]morpholine |
|---|---|
| PubChem CID | 157045730 |
| Molecular Formula | C17H18F3N5O |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 4-[7-methyl-4-[3-(trifluoromethyl)-1-bicyclo[1.1.1]pentanyl]pteridin-2-yl]morpholine |
| SMILES | Cc1cnc2c(C34CC(C(F)(F)F)(C3)C4)nc(N3CCOCC3)nc2n1 |
| InChI | InChI=1S/C17H18F3N5O/c1-10-6-21-11-12(15-7-16(8-15,9-15)17(18,19)20)23-14(24-13(11)22-10)25-2-4-26-5-3-25/h6H,2-5,7-9H2,1H3 |
| InChIKey | FZBSBMQBURPTFF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 64.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |