C24H27ClFN7O — CID 157044637
4-[4-(4-chloro-2-fluorophenyl)-6,7-dimethylpteridin-2-yl]morpholine;(Z)-3-cyclopropyliminoprop-1-en-1-amine (PubChem CID 157044637) has the molecular formula C24H27ClFN7O and a molecular weight of 483.98 g/mol. Its IUPAC name is 4-[4-(4-chloro-2-fluorophenyl)-6,7-dimethylpteridin-2-yl]morpholine;(Z)-3-cyclopropyliminoprop-1-en-1-amine.
| Compound Name | 4-[4-(4-chloro-2-fluorophenyl)-6,7-dimethylpteridin-2-yl]morpholine;(Z)-3-cyclopropyliminoprop-1-en-1-amine |
|---|---|
| PubChem CID | 157044637 |
| Molecular Formula | C24H27ClFN7O |
| Molecular Weight | 483.98 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | 4-[4-(4-chloro-2-fluorophenyl)-6,7-dimethylpteridin-2-yl]morpholine;(Z)-3-cyclopropyliminoprop-1-en-1-amine |
| SMILES | Cc1nc2nc(N3CCOCC3)nc(-c3ccc(Cl)cc3F)c2nc1C.N/C=C\C=N\C1CC1 |
| InChI | InChI=1S/C18H17ClFN5O.C6H10N2/c1-10-11(2)22-17-16(21-10)15(13-4-3-12(19)9-14(13)20)23-18(24-17)25-5-7-26-8-6-25;7-4-1-5-8-6-2-3-6/h3-4,9H,5-8H2,1-2H3;1,4-6H,2-3,7H2/b;4-1-,8-5+ |
| InChIKey | PKVZFTPNTUNBDD-JKWLNEMPSA-N |
| XLogP | 4.02 |
| TPSA | 102.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.98 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|