C19H18ClFN4O2 — CID 166122294
4-[4-(4-chloro-2-fluorophenyl)-6,7-dimethylpteridin-2-yl]oxan-4-ol (PubChem CID 166122294) has the molecular formula C19H18ClFN4O2 and a molecular weight of 388.83 g/mol. Its IUPAC name is 4-[4-(4-chloro-2-fluorophenyl)-6,7-dimethylpteridin-2-yl]oxan-4-ol.
| Compound Name | 4-[4-(4-chloro-2-fluorophenyl)-6,7-dimethylpteridin-2-yl]oxan-4-ol |
|---|---|
| PubChem CID | 166122294 |
| Molecular Formula | C19H18ClFN4O2 |
| Molecular Weight | 388.83 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 4-[4-(4-chloro-2-fluorophenyl)-6,7-dimethylpteridin-2-yl]oxan-4-ol |
| SMILES | Cc1nc2nc(C3(O)CCOCC3)nc(-c3ccc(Cl)cc3F)c2nc1C |
| InChI | InChI=1S/C19H18ClFN4O2/c1-10-11(2)23-17-16(22-10)15(13-4-3-12(20)9-14(13)21)24-18(25-17)19(26)5-7-27-8-6-19/h3-4,9,26H,5-8H2,1-2H3 |
| InChIKey | YXNYAZCKDARGDW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 81.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.83 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |