C23H26ClFN6O — CID 157044828
4-(4-chloro-2-fluorophenyl)-6,7-dimethylpteridine;1-methylpyrazole;oxane (PubChem CID 157044828) has the molecular formula C23H26ClFN6O and a molecular weight of 456.95 g/mol. Its IUPAC name is 4-(4-chloro-2-fluorophenyl)-6,7-dimethylpteridine;1-methylpyrazole;oxane.
| Compound Name | 4-(4-chloro-2-fluorophenyl)-6,7-dimethylpteridine;1-methylpyrazole;oxane |
|---|---|
| PubChem CID | 157044828 |
| Molecular Formula | C23H26ClFN6O |
| Molecular Weight | 456.95 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 4-(4-chloro-2-fluorophenyl)-6,7-dimethylpteridine;1-methylpyrazole;oxane |
| SMILES | C1CCOCC1.Cc1nc2ncnc(-c3ccc(Cl)cc3F)c2nc1C.Cn1cccn1 |
| InChI | InChI=1S/C14H10ClFN4.C5H10O.C4H6N2/c1-7-8(2)20-14-13(19-7)12(17-6-18-14)10-4-3-9(15)5-11(10)16;1-2-4-6-5-3-1;1-6-4-2-3-5-6/h3-6H,1-2H3;1-5H2;2-4H,1H3 |
| InChIKey | ZQELDSGKFCNNNS-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 78.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.95 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |