C26H30F2N6O — CID 166122534
1-cyclopropylpyrazole;4-(2,4-difluorophenyl)-6,7-dimethylpteridine;oxepane (PubChem CID 166122534) has the molecular formula C26H30F2N6O and a molecular weight of 480.56 g/mol. Its IUPAC name is 1-cyclopropylpyrazole;4-(2,4-difluorophenyl)-6,7-dimethylpteridine;oxepane.
| Compound Name | 1-cyclopropylpyrazole;4-(2,4-difluorophenyl)-6,7-dimethylpteridine;oxepane |
|---|---|
| PubChem CID | 166122534 |
| Molecular Formula | C26H30F2N6O |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | 1-cyclopropylpyrazole;4-(2,4-difluorophenyl)-6,7-dimethylpteridine;oxepane |
| SMILES | C1CCCOCC1.Cc1nc2ncnc(-c3ccc(F)cc3F)c2nc1C.c1cnn(C2CC2)c1 |
| InChI | InChI=1S/C14H10F2N4.C6H8N2.C6H12O/c1-7-8(2)20-14-13(19-7)12(17-6-18-14)10-4-3-9(15)5-11(10)16;1-4-7-8(5-1)6-2-3-6;1-2-4-6-7-5-3-1/h3-6H,1-2H3;1,4-6H,2-3H2;1-6H2 |
| InChIKey | VYGZYHWXFOJRLH-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 78.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |