C25H23B3F2N6O — CID 166121814
CID 166121814 (PubChem CID 166121814) has the molecular formula C25H23B3F2N6O and a molecular weight of 493.93 g/mol.
| Compound Name | CID 166121814 |
|---|---|
| PubChem CID | 166121814 |
| Molecular Formula | C25H23B3F2N6O |
| Molecular Weight | 493.93 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | — |
| SMILES | [B]C1CC(c2nc(-c3ccc(F)cc3F)c3nc(C)c(C)nc3n2)CC([B])([B])O1.c1cnn(C2CC2)c1 |
| InChI | InChI=1S/C19H15B3F2N4O.C6H8N2/c1-8-9(2)26-18-16(25-8)15(12-4-3-11(23)6-13(12)24)27-17(28-18)10-5-14(20)29-19(21,22)7-10;1-4-7-8(5-1)6-2-3-6/h3-4,6,10,14H,5,7H2,1-2H3;1,4-6H,2-3H2 |
| InChIKey | NYMGLFPAJCNLFI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 78.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.93 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|