C25H22B2F2N6O — CID 166122412
CID 166122412 (PubChem CID 166122412) has the molecular formula C25H22B2F2N6O and a molecular weight of 482.11 g/mol.
| Compound Name | CID 166122412 |
|---|---|
| PubChem CID | 166122412 |
| Molecular Formula | C25H22B2F2N6O |
| Molecular Weight | 482.11 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | — |
| SMILES | [B]C1([B])CC(c2nc(-c3ccc(F)cc3F)c3nc(C)c(C)nc3n2)CC(c2cnn(C3CC3)c2)O1 |
| InChI | InChI=1S/C25H22B2F2N6O/c1-12-13(2)32-24-22(31-12)21(18-6-3-16(28)8-19(18)29)33-23(34-24)14-7-20(36-25(26,27)9-14)15-10-30-35(11-15)17-4-5-17/h3,6,8,10-11,14,17,20H,4-5,7,9H2,1-2H3 |
| InChIKey | XRVHTZRBEHQPGA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 78.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.11 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|