C26H25F3N6O — CID 166122734
2-[(2R,4R,6R)-2-(1-cyclopropylpyrazol-4-yl)-6-methyloxan-4-yl]-6,7-dimethyl-4-(2,4,5-trifluorophenyl)pteridine (PubChem CID 166122734) has the molecular formula C26H25F3N6O and a molecular weight of 494.52 g/mol. Its IUPAC name is 2-[(2R,4R,6R)-2-(1-cyclopropylpyrazol-4-yl)-6-methyloxan-4-yl]-6,7-dimethyl-4-(2,4,5-trifluorophenyl)pteridine.
| Compound Name | 2-[(2R,4R,6R)-2-(1-cyclopropylpyrazol-4-yl)-6-methyloxan-4-yl]-6,7-dimethyl-4-(2,4,5-trifluorophenyl)pteridine |
|---|---|
| PubChem CID | 166122734 |
| Molecular Formula | C26H25F3N6O |
| Molecular Weight | 494.52 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 2-[(2R,4R,6R)-2-(1-cyclopropylpyrazol-4-yl)-6-methyloxan-4-yl]-6,7-dimethyl-4-(2,4,5-trifluorophenyl)pteridine |
| SMILES | Cc1nc2nc([C@@H]3C[C@@H](C)O[C@@H](c4cnn(C5CC5)c4)C3)nc(-c3cc(F)c(F)cc3F)c2nc1C |
| InChI | InChI=1S/C26H25F3N6O/c1-12-6-15(7-22(36-12)16-10-30-35(11-16)17-4-5-17)25-33-23(18-8-20(28)21(29)9-19(18)27)24-26(34-25)32-14(3)13(2)31-24/h8-12,15,17,22H,4-7H2,1-3H3/t12-,15-,22-/m1/s1 |
| InChIKey | KDSBDKHEXPDEGN-AVKZDSLQSA-N |
| XLogP | 5.68 |
| TPSA | 78.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.52 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|