C27H27F2N5O — CID 157045817
7-[(2S,4R,6S)-2-(1-cyclopropylpyrazol-4-yl)-6-methyloxan-4-yl]-5-(2,4-difluorophenyl)-2,3-dimethylpyrido[3,4-b]pyrazine (PubChem CID 157045817) has the molecular formula C27H27F2N5O and a molecular weight of 475.54 g/mol. Its IUPAC name is 7-[(2S,4R,6S)-2-(1-cyclopropylpyrazol-4-yl)-6-methyloxan-4-yl]-5-(2,4-difluorophenyl)-2,3-dimethylpyrido[3,4-b]pyrazine.
| Compound Name | 7-[(2S,4R,6S)-2-(1-cyclopropylpyrazol-4-yl)-6-methyloxan-4-yl]-5-(2,4-difluorophenyl)-2,3-dimethylpyrido[3,4-b]pyrazine |
|---|---|
| PubChem CID | 157045817 |
| Molecular Formula | C27H27F2N5O |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | 7-[(2S,4R,6S)-2-(1-cyclopropylpyrazol-4-yl)-6-methyloxan-4-yl]-5-(2,4-difluorophenyl)-2,3-dimethylpyrido[3,4-b]pyrazine |
| SMILES | Cc1nc2cc([C@H]3C[C@@H](c4cnn(C5CC5)c4)O[C@@H](C)C3)nc(-c3ccc(F)cc3F)c2nc1C |
| InChI | InChI=1S/C27H27F2N5O/c1-14-8-17(9-25(35-14)18-12-30-34(13-18)20-5-6-20)23-11-24-27(32-16(3)15(2)31-24)26(33-23)21-7-4-19(28)10-22(21)29/h4,7,10-14,17,20,25H,5-6,8-9H2,1-3H3/t14-,17+,25-/m0/s1 |
| InChIKey | JJEYJHUNCZQKFS-AXUAAXHCSA-N |
| XLogP | 6.14 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |