C28H26F5N5O2 — CID 166122780
7-[(2S,4S)-2-(1-cyclopropylpyrazol-4-yl)oxan-4-yl]-5-(2,4-difluorophenyl)-2-methyl-3-(2,2,2-trifluoroethoxymethyl)pyrido[3,4-b]pyrazine (PubChem CID 166122780) has the molecular formula C28H26F5N5O2 and a molecular weight of 559.54 g/mol. Its IUPAC name is 7-[(2S,4S)-2-(1-cyclopropylpyrazol-4-yl)oxan-4-yl]-5-(2,4-difluorophenyl)-2-methyl-3-(2,2,2-trifluoroethoxymethyl)pyrido[3,4-b]pyrazine.
| Compound Name | 7-[(2S,4S)-2-(1-cyclopropylpyrazol-4-yl)oxan-4-yl]-5-(2,4-difluorophenyl)-2-methyl-3-(2,2,2-trifluoroethoxymethyl)pyrido[3,4-b]pyrazine |
|---|---|
| PubChem CID | 166122780 |
| Molecular Formula | C28H26F5N5O2 |
| Molecular Weight | 559.54 g/mol |
| Exact Mass | 559.20 |
| IUPAC Name | 7-[(2S,4S)-2-(1-cyclopropylpyrazol-4-yl)oxan-4-yl]-5-(2,4-difluorophenyl)-2-methyl-3-(2,2,2-trifluoroethoxymethyl)pyrido[3,4-b]pyrazine |
| SMILES | Cc1nc2cc([C@H]3CCO[C@H](c4cnn(C5CC5)c4)C3)nc(-c3ccc(F)cc3F)c2nc1COCC(F)(F)F |
| InChI | InChI=1S/C28H26F5N5O2/c1-15-24(13-39-14-28(31,32)33)37-27-23(35-15)10-22(36-26(27)20-5-2-18(29)9-21(20)30)16-6-7-40-25(8-16)17-11-34-38(12-17)19-3-4-19/h2,5,9-12,16,19,25H,3-4,6-8,13-14H2,1H3/t16-,25-/m0/s1 |
| InChIKey | XSBVDISYYIEHSE-LMKMVOKYSA-N |
| XLogP | 6.52 |
| TPSA | 74.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.54 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |