C14H8F4N4 — CID 166121869
6-(difluoromethyl)-4-(2,4-difluorophenyl)-7-methylpteridine (PubChem CID 166121869) has the molecular formula C14H8F4N4 and a molecular weight of 308.24 g/mol. Its IUPAC name is 6-(difluoromethyl)-4-(2,4-difluorophenyl)-7-methylpteridine.
| Compound Name | 6-(difluoromethyl)-4-(2,4-difluorophenyl)-7-methylpteridine |
|---|---|
| PubChem CID | 166121869 |
| Molecular Formula | C14H8F4N4 |
| Molecular Weight | 308.24 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 6-(difluoromethyl)-4-(2,4-difluorophenyl)-7-methylpteridine |
| SMILES | Cc1nc2ncnc(-c3ccc(F)cc3F)c2nc1C(F)F |
| InChI | InChI=1S/C14H8F4N4/c1-6-10(13(17)18)22-12-11(19-5-20-14(12)21-6)8-3-2-7(15)4-9(8)16/h2-5,13H,1H3 |
| InChIKey | JMEPOCZXEJJZKY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.24 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |