C14H9ClF2N4 — CID 178120678
2-chloro-4-(2,5-difluorophenyl)-6,7-dimethylpteridine (PubChem CID 178120678) has the molecular formula C14H9ClF2N4 and a molecular weight of 306.70 g/mol. Its IUPAC name is 2-chloro-4-(2,5-difluorophenyl)-6,7-dimethylpteridine.
| Compound Name | 2-chloro-4-(2,5-difluorophenyl)-6,7-dimethylpteridine |
|---|---|
| PubChem CID | 178120678 |
| Molecular Formula | C14H9ClF2N4 |
| Molecular Weight | 306.70 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 2-chloro-4-(2,5-difluorophenyl)-6,7-dimethylpteridine |
| SMILES | Cc1nc2nc(Cl)nc(-c3cc(F)ccc3F)c2nc1C |
| InChI | InChI=1S/C14H9ClF2N4/c1-6-7(2)19-13-12(18-6)11(20-14(15)21-13)9-5-8(16)3-4-10(9)17/h3-5H,1-2H3 |
| InChIKey | SFJFGAHJNTXNOX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.70 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |