C15H12Cl2N4 — CID 157045018
2-chloro-4-(4-chloro-2-methylphenyl)-6,7-dimethylpteridine (PubChem CID 157045018) has the molecular formula C15H12Cl2N4 and a molecular weight of 319.20 g/mol. Its IUPAC name is 2-chloro-4-(4-chloro-2-methylphenyl)-6,7-dimethylpteridine.
| Compound Name | 2-chloro-4-(4-chloro-2-methylphenyl)-6,7-dimethylpteridine |
|---|---|
| PubChem CID | 157045018 |
| Molecular Formula | C15H12Cl2N4 |
| Molecular Weight | 319.20 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 2-chloro-4-(4-chloro-2-methylphenyl)-6,7-dimethylpteridine |
| SMILES | Cc1cc(Cl)ccc1-c1nc(Cl)nc2nc(C)c(C)nc12 |
| InChI | InChI=1S/C15H12Cl2N4/c1-7-6-10(16)4-5-11(7)12-13-14(21-15(17)20-12)19-9(3)8(2)18-13/h4-6H,1-3H3 |
| InChIKey | TZTGNRQNCYEFCU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.20 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |