About 2-chloro-4-(4-chloro-2,5-difluorophenyl)-6,7-dimethylpteridine
2-chloro-4-(4-chloro-2,5-difluorophenyl)-6,7-dimethylpteridine (PubChem CID 157044910) has the molecular formula C14H8Cl2F2N4
and a molecular weight of 341.15 g/mol. Its IUPAC name is 2-chloro-4-(4-chloro-2,5-difluorophenyl)-6,7-dimethylpteridine.
Molecular Properties
| Compound Name | 2-chloro-4-(4-chloro-2,5-difluorophenyl)-6,7-dimethylpteridine |
| PubChem CID | 157044910 |
| Molecular Formula | C14H8Cl2F2N4 |
| Molecular Weight | 341.15 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | 2-chloro-4-(4-chloro-2,5-difluorophenyl)-6,7-dimethylpteridine |
| SMILES | Cc1nc2nc(Cl)nc(-c3cc(F)c(Cl)cc3F)c2nc1C |
| InChI | InChI=1S/C14H8Cl2F2N4/c1-5-6(2)20-13-12(19-5)11(21-14(16)22-13)7-3-10(18)8(15)4-9(7)17/h3-4H,1-2H3 |
| InChIKey | YRFYGTUOCZWWFT-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.15 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-(4-chloro-2,5-difluorophenyl)-6,7-dimethylpteridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-(4-chloro-2,5-difluorophenyl)-6,7-dimethylpteridine?
The IUPAC name of 2-chloro-4-(4-chloro-2,5-difluorophenyl)-6,7-dimethylpteridine (CID 157044910) is 2-chloro-4-(4-chloro-2,5-difluorophenyl)-6,7-dimethylpteridine.
What is the SMILES notation for 2-chloro-4-(4-chloro-2,5-difluorophenyl)-6,7-dimethylpteridine?
The canonical SMILES for 2-chloro-4-(4-chloro-2,5-difluorophenyl)-6,7-dimethylpteridine is Cc1nc2nc(Cl)nc(-c3cc(F)c(Cl)cc3F)c2nc1C.
What is the InChIKey of 2-chloro-4-(4-chloro-2,5-difluorophenyl)-6,7-dimethylpteridine?
The InChIKey is YRFYGTUOCZWWFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8Cl2F2N4/c1-5-6(2)20-13-12(19-5)11(21-14(16)22-13)7-3-10(18)8(15)4-9(7)17/h3-4H,1-2H3.
What are the key properties of 2-chloro-4-(4-chloro-2,5-difluorophenyl)-6,7-dimethylpteridine?
2-chloro-4-(4-chloro-2,5-difluorophenyl)-6,7-dimethylpteridine has a molecular weight of 341.15 g/mol, XLogP of 4.29, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-(4-chloro-2,5-difluorophenyl)-6,7-dimethylpteridine is sourced from PubChem (CID 157044910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).