C24H21ClF2N6O — CID 157045863
(2S)-4-[4-(4-chloro-2,5-difluorophenyl)-6,7-dimethylpteridin-2-yl]-2-(2-methyl-4-pyridinyl)morpholine (PubChem CID 157045863) has the molecular formula C24H21ClF2N6O and a molecular weight of 482.92 g/mol. Its IUPAC name is (2S)-4-[4-(4-chloro-2,5-difluorophenyl)-6,7-dimethylpteridin-2-yl]-2-(2-methyl-4-pyridinyl)morpholine.
| Compound Name | (2S)-4-[4-(4-chloro-2,5-difluorophenyl)-6,7-dimethylpteridin-2-yl]-2-(2-methyl-4-pyridinyl)morpholine |
|---|---|
| PubChem CID | 157045863 |
| Molecular Formula | C24H21ClF2N6O |
| Molecular Weight | 482.92 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | (2S)-4-[4-(4-chloro-2,5-difluorophenyl)-6,7-dimethylpteridin-2-yl]-2-(2-methyl-4-pyridinyl)morpholine |
| SMILES | Cc1cc([C@H]2CN(c3nc(-c4cc(F)c(Cl)cc4F)c4nc(C)c(C)nc4n3)CCO2)ccn1 |
| InChI | InChI=1S/C24H21ClF2N6O/c1-12-8-15(4-5-28-12)20-11-33(6-7-34-20)24-31-21(16-9-19(27)17(25)10-18(16)26)22-23(32-24)30-14(3)13(2)29-22/h4-5,8-10,20H,6-7,11H2,1-3H3/t20-/m1/s1 |
| InChIKey | BIFNNWJNNDRTKY-HXUWFJFHSA-N |
| XLogP | 4.92 |
| TPSA | 76.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.92 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|