C23H25F3N6O — CID 167284147
(2R)-4-[6,7-dimethyl-4-[3-(trifluoromethyl)but-3-enyl]pteridin-2-yl]-2-(2-methyl-4-pyridinyl)morpholine (PubChem CID 167284147) has the molecular formula C23H25F3N6O and a molecular weight of 458.49 g/mol. Its IUPAC name is (2R)-4-[6,7-dimethyl-4-[3-(trifluoromethyl)but-3-enyl]pteridin-2-yl]-2-(2-methyl-4-pyridinyl)morpholine.
| Compound Name | (2R)-4-[6,7-dimethyl-4-[3-(trifluoromethyl)but-3-enyl]pteridin-2-yl]-2-(2-methyl-4-pyridinyl)morpholine |
|---|---|
| PubChem CID | 167284147 |
| Molecular Formula | C23H25F3N6O |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | (2R)-4-[6,7-dimethyl-4-[3-(trifluoromethyl)but-3-enyl]pteridin-2-yl]-2-(2-methyl-4-pyridinyl)morpholine |
| SMILES | C=C(CCc1nc(N2CCO[C@H](c3ccnc(C)c3)C2)nc2nc(C)c(C)nc12)C(F)(F)F |
| InChI | InChI=1S/C23H25F3N6O/c1-13(23(24,25)26)5-6-18-20-21(29-16(4)15(3)28-20)31-22(30-18)32-9-10-33-19(12-32)17-7-8-27-14(2)11-17/h7-8,11,19H,1,5-6,9-10,12H2,2-4H3/t19-/m0/s1 |
| InChIKey | NBPIWJMSVKPHGA-IBGZPJMESA-N |
| XLogP | 4.37 |
| TPSA | 76.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|