C15H15Cl2N3O — CID 56880782
2-(3,4-dichlorophenyl)-4-(4-methylpyrimidin-2-yl)morpholine (PubChem CID 56880782) has the molecular formula C15H15Cl2N3O and a molecular weight of 324.21 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-4-(4-methylpyrimidin-2-yl)morpholine.
| Compound Name | 2-(3,4-dichlorophenyl)-4-(4-methylpyrimidin-2-yl)morpholine |
|---|---|
| PubChem CID | 56880782 |
| Molecular Formula | C15H15Cl2N3O |
| Molecular Weight | 324.21 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-4-(4-methylpyrimidin-2-yl)morpholine |
| SMILES | Cc1ccnc(N2CCOC(c3ccc(Cl)c(Cl)c3)C2)n1 |
| InChI | InChI=1S/C15H15Cl2N3O/c1-10-4-5-18-15(19-10)20-6-7-21-14(9-20)11-2-3-12(16)13(17)8-11/h2-5,8,14H,6-7,9H2,1H3 |
| InChIKey | NFUAFDAPDBOQMT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.21 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |