C15H16Cl2N4O — CID 95175522
4-[(2S)-2-(3,4-dichlorophenyl)morpholin-4-yl]-6-methylpyrimidin-2-amine (PubChem CID 95175522) has the molecular formula C15H16Cl2N4O and a molecular weight of 339.23 g/mol. Its IUPAC name is 4-[(2S)-2-(3,4-dichlorophenyl)morpholin-4-yl]-6-methylpyrimidin-2-amine.
| Compound Name | 4-[(2S)-2-(3,4-dichlorophenyl)morpholin-4-yl]-6-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 95175522 |
| Molecular Formula | C15H16Cl2N4O |
| Molecular Weight | 339.23 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 4-[(2S)-2-(3,4-dichlorophenyl)morpholin-4-yl]-6-methylpyrimidin-2-amine |
| SMILES | Cc1cc(N2CCO[C@@H](c3ccc(Cl)c(Cl)c3)C2)nc(N)n1 |
| InChI | InChI=1S/C15H16Cl2N4O/c1-9-6-14(20-15(18)19-9)21-4-5-22-13(8-21)10-2-3-11(16)12(17)7-10/h2-3,6-7,13H,4-5,8H2,1H3,(H2,18,19,20)/t13-/m1/s1 |
| InChIKey | COQGDJGJJVLVGR-CYBMUJFWSA-N |
| XLogP | 3.25 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.23 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |