C15H15Cl2N3O2 — CID 95551468
(2R)-2-(3,4-dichlorophenyl)-4-(6-methoxypyrimidin-4-yl)morpholine (PubChem CID 95551468) has the molecular formula C15H15Cl2N3O2 and a molecular weight of 340.21 g/mol. Its IUPAC name is (2R)-2-(3,4-dichlorophenyl)-4-(6-methoxypyrimidin-4-yl)morpholine.
| Compound Name | (2R)-2-(3,4-dichlorophenyl)-4-(6-methoxypyrimidin-4-yl)morpholine |
|---|---|
| PubChem CID | 95551468 |
| Molecular Formula | C15H15Cl2N3O2 |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | (2R)-2-(3,4-dichlorophenyl)-4-(6-methoxypyrimidin-4-yl)morpholine |
| SMILES | COc1cc(N2CCO[C@H](c3ccc(Cl)c(Cl)c3)C2)ncn1 |
| InChI | InChI=1S/C15H15Cl2N3O2/c1-21-15-7-14(18-9-19-15)20-4-5-22-13(8-20)10-2-3-11(16)12(17)6-10/h2-3,6-7,9,13H,4-5,8H2,1H3/t13-/m0/s1 |
| InChIKey | MMSRWRRDNQSCDC-ZDUSSCGKSA-N |
| XLogP | 3.37 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |