C18H20Cl2N4O2 — CID 95551993
(2R)-2-(3,4-dichlorophenyl)-4-(6-morpholin-4-ylpyrimidin-4-yl)morpholine (PubChem CID 95551993) has the molecular formula C18H20Cl2N4O2 and a molecular weight of 395.29 g/mol. Its IUPAC name is (2R)-2-(3,4-dichlorophenyl)-4-(6-morpholin-4-ylpyrimidin-4-yl)morpholine.
| Compound Name | (2R)-2-(3,4-dichlorophenyl)-4-(6-morpholin-4-ylpyrimidin-4-yl)morpholine |
|---|---|
| PubChem CID | 95551993 |
| Molecular Formula | C18H20Cl2N4O2 |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | (2R)-2-(3,4-dichlorophenyl)-4-(6-morpholin-4-ylpyrimidin-4-yl)morpholine |
| SMILES | Clc1ccc([C@@H]2CN(c3cc(N4CCOCC4)ncn3)CCO2)cc1Cl |
| InChI | InChI=1S/C18H20Cl2N4O2/c19-14-2-1-13(9-15(14)20)16-11-24(5-8-26-16)18-10-17(21-12-22-18)23-3-6-25-7-4-23/h1-2,9-10,12,16H,3-8,11H2/t16-/m0/s1 |
| InChIKey | WSVSTFVCJHXPET-INIZCTEOSA-N |
| XLogP | 3.20 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |