C20H21N3O3 — CID 95560815
(2S)-2-(6-methoxynaphthalen-2-yl)-4-(6-methoxypyrimidin-4-yl)morpholine (PubChem CID 95560815) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is (2S)-2-(6-methoxynaphthalen-2-yl)-4-(6-methoxypyrimidin-4-yl)morpholine.
| Compound Name | (2S)-2-(6-methoxynaphthalen-2-yl)-4-(6-methoxypyrimidin-4-yl)morpholine |
|---|---|
| PubChem CID | 95560815 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | (2S)-2-(6-methoxynaphthalen-2-yl)-4-(6-methoxypyrimidin-4-yl)morpholine |
| SMILES | COc1ccc2cc([C@H]3CN(c4cc(OC)ncn4)CCO3)ccc2c1 |
| InChI | InChI=1S/C20H21N3O3/c1-24-17-6-5-14-9-16(4-3-15(14)10-17)18-12-23(7-8-26-18)19-11-20(25-2)22-13-21-19/h3-6,9-11,13,18H,7-8,12H2,1-2H3/t18-/m1/s1 |
| InChIKey | LLWOJVCGMZQJRF-GOSISDBHSA-N |
| XLogP | 3.22 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |