C23H21N3O2 — CID 95551868
(2R)-2-(6-methoxynaphthalen-2-yl)-4-quinoxalin-2-ylmorpholine (PubChem CID 95551868) has the molecular formula C23H21N3O2 and a molecular weight of 371.44 g/mol. Its IUPAC name is (2R)-2-(6-methoxynaphthalen-2-yl)-4-quinoxalin-2-ylmorpholine.
| Compound Name | (2R)-2-(6-methoxynaphthalen-2-yl)-4-quinoxalin-2-ylmorpholine |
|---|---|
| PubChem CID | 95551868 |
| Molecular Formula | C23H21N3O2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | (2R)-2-(6-methoxynaphthalen-2-yl)-4-quinoxalin-2-ylmorpholine |
| SMILES | COc1ccc2cc([C@@H]3CN(c4cnc5ccccc5n4)CCO3)ccc2c1 |
| InChI | InChI=1S/C23H21N3O2/c1-27-19-9-8-16-12-18(7-6-17(16)13-19)22-15-26(10-11-28-22)23-14-24-20-4-2-3-5-21(20)25-23/h2-9,12-14,22H,10-11,15H2,1H3/t22-/m0/s1 |
| InChIKey | YZHLBUVOGVRZNK-QFIPXVFZSA-N |
| XLogP | 4.37 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |