C16H16N4OS — CID 95138385
(2S)-2-(4-methyl-1,3-thiazol-2-yl)-4-quinoxalin-2-ylmorpholine (PubChem CID 95138385) has the molecular formula C16H16N4OS and a molecular weight of 312.40 g/mol. Its IUPAC name is (2S)-2-(4-methyl-1,3-thiazol-2-yl)-4-quinoxalin-2-ylmorpholine.
| Compound Name | (2S)-2-(4-methyl-1,3-thiazol-2-yl)-4-quinoxalin-2-ylmorpholine |
|---|---|
| PubChem CID | 95138385 |
| Molecular Formula | C16H16N4OS |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | (2S)-2-(4-methyl-1,3-thiazol-2-yl)-4-quinoxalin-2-ylmorpholine |
| SMILES | Cc1csc([C@@H]2CN(c3cnc4ccccc4n3)CCO2)n1 |
| InChI | InChI=1S/C16H16N4OS/c1-11-10-22-16(18-11)14-9-20(6-7-21-14)15-8-17-12-4-2-3-5-13(12)19-15/h2-5,8,10,14H,6-7,9H2,1H3/t14-/m0/s1 |
| InChIKey | WOHMAEXIPMZKHQ-AWEZNQCLSA-N |
| XLogP | 2.97 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |