C16H18BrN3O — CID 47983335
2-(4-bromophenyl)-4-(4,6-dimethylpyrimidin-2-yl)morpholine (PubChem CID 47983335) has the molecular formula C16H18BrN3O and a molecular weight of 348.24 g/mol. Its IUPAC name is 2-(4-bromophenyl)-4-(4,6-dimethylpyrimidin-2-yl)morpholine.
| Compound Name | 2-(4-bromophenyl)-4-(4,6-dimethylpyrimidin-2-yl)morpholine |
|---|---|
| PubChem CID | 47983335 |
| Molecular Formula | C16H18BrN3O |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 2-(4-bromophenyl)-4-(4,6-dimethylpyrimidin-2-yl)morpholine |
| SMILES | Cc1cc(C)nc(N2CCOC(c3ccc(Br)cc3)C2)n1 |
| InChI | InChI=1S/C16H18BrN3O/c1-11-9-12(2)19-16(18-11)20-7-8-21-15(10-20)13-3-5-14(17)6-4-13/h3-6,9,15H,7-8,10H2,1-2H3 |
| InChIKey | CKLXPTCDDBBFML-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |