C19H16BrFN2O — CID 97077681
(2R)-2-(4-bromophenyl)-4-(7-fluoroisoquinolin-1-yl)morpholine (PubChem CID 97077681) has the molecular formula C19H16BrFN2O and a molecular weight of 387.25 g/mol. Its IUPAC name is (2R)-2-(4-bromophenyl)-4-(7-fluoroisoquinolin-1-yl)morpholine.
| Compound Name | (2R)-2-(4-bromophenyl)-4-(7-fluoroisoquinolin-1-yl)morpholine |
|---|---|
| PubChem CID | 97077681 |
| Molecular Formula | C19H16BrFN2O |
| Molecular Weight | 387.25 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | (2R)-2-(4-bromophenyl)-4-(7-fluoroisoquinolin-1-yl)morpholine |
| SMILES | Fc1ccc2ccnc(N3CCO[C@H](c4ccc(Br)cc4)C3)c2c1 |
| InChI | InChI=1S/C19H16BrFN2O/c20-15-4-1-14(2-5-15)18-12-23(9-10-24-18)19-17-11-16(21)6-3-13(17)7-8-22-19/h1-8,11,18H,9-10,12H2/t18-/m0/s1 |
| InChIKey | YRMAHTUNPUKBTO-SFHVURJKSA-N |
| XLogP | 4.71 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.25 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |