About 4-(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)-2-(4-fluorophenyl)morpholine
4-(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)-2-(4-fluorophenyl)morpholine (PubChem CID 133290851) has the molecular formula C21H21FN4O
and a molecular weight of 364.42 g/mol. Its IUPAC name is 4-(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)-2-(4-fluorophenyl)morpholine.
Molecular Properties
| Compound Name | 4-(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)-2-(4-fluorophenyl)morpholine |
| PubChem CID | 133290851 |
| Molecular Formula | C21H21FN4O |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 4-(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)-2-(4-fluorophenyl)morpholine |
| SMILES | Cc1nc(-c2ccccn2)nc(N2CCOC(c3ccc(F)cc3)C2)c1C |
| InChI | InChI=1S/C21H21FN4O/c1-14-15(2)24-20(18-5-3-4-10-23-18)25-21(14)26-11-12-27-19(13-26)16-6-8-17(22)9-7-16/h3-10,19H,11-13H2,1-2H3 |
| InChIKey | MYWPYMPRZNGQAX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)-2-(4-fluorophenyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)-2-(4-fluorophenyl)morpholine?
The IUPAC name of 4-(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)-2-(4-fluorophenyl)morpholine (CID 133290851) is 4-(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)-2-(4-fluorophenyl)morpholine.
What is the SMILES notation for 4-(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)-2-(4-fluorophenyl)morpholine?
The canonical SMILES for 4-(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)-2-(4-fluorophenyl)morpholine is Cc1nc(-c2ccccn2)nc(N2CCOC(c3ccc(F)cc3)C2)c1C.
What is the InChIKey of 4-(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)-2-(4-fluorophenyl)morpholine?
The InChIKey is MYWPYMPRZNGQAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21FN4O/c1-14-15(2)24-20(18-5-3-4-10-23-18)25-21(14)26-11-12-27-19(13-26)16-6-8-17(22)9-7-16/h3-10,19H,11-13H2,1-2H3.
What are the key properties of 4-(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)-2-(4-fluorophenyl)morpholine?
4-(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)-2-(4-fluorophenyl)morpholine has a molecular weight of 364.42 g/mol, XLogP of 3.87, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)-2-(4-fluorophenyl)morpholine is sourced from PubChem (CID 133290851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).