C17H20FN3O — CID 133363508
2-(2-fluorophenyl)-4-(2,5,6-trimethylpyrimidin-4-yl)morpholine (PubChem CID 133363508) has the molecular formula C17H20FN3O and a molecular weight of 301.37 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-4-(2,5,6-trimethylpyrimidin-4-yl)morpholine.
| Compound Name | 2-(2-fluorophenyl)-4-(2,5,6-trimethylpyrimidin-4-yl)morpholine |
|---|---|
| PubChem CID | 133363508 |
| Molecular Formula | C17H20FN3O |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 2-(2-fluorophenyl)-4-(2,5,6-trimethylpyrimidin-4-yl)morpholine |
| SMILES | Cc1nc(C)c(C)c(N2CCOC(c3ccccc3F)C2)n1 |
| InChI | InChI=1S/C17H20FN3O/c1-11-12(2)19-13(3)20-17(11)21-8-9-22-16(10-21)14-6-4-5-7-15(14)18/h4-7,16H,8-10H2,1-3H3 |
| InChIKey | HJNOGUNAZCSPDN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |