C14H17N5O — CID 110103191
4-(4,6-dimethylpyrimidin-2-yl)-2-pyrazin-2-ylmorpholine (PubChem CID 110103191) has the molecular formula C14H17N5O and a molecular weight of 271.32 g/mol. Its IUPAC name is 4-(4,6-dimethylpyrimidin-2-yl)-2-pyrazin-2-ylmorpholine.
| Compound Name | 4-(4,6-dimethylpyrimidin-2-yl)-2-pyrazin-2-ylmorpholine |
|---|---|
| PubChem CID | 110103191 |
| Molecular Formula | C14H17N5O |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 4-(4,6-dimethylpyrimidin-2-yl)-2-pyrazin-2-ylmorpholine |
| SMILES | Cc1cc(C)nc(N2CCOC(c3cnccn3)C2)n1 |
| InChI | InChI=1S/C14H17N5O/c1-10-7-11(2)18-14(17-10)19-5-6-20-13(9-19)12-8-15-3-4-16-12/h3-4,7-8,13H,5-6,9H2,1-2H3 |
| InChIKey | FBEAOXQNEPUSLX-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 64.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |