C13H8Cl2F2N4 — CID 82771182
8-chloro-3-(4-chloro-2,5-difluorophenyl)-5,6-dimethyl-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 82771182) has the molecular formula C13H8Cl2F2N4 and a molecular weight of 329.14 g/mol. Its IUPAC name is 8-chloro-3-(4-chloro-2,5-difluorophenyl)-5,6-dimethyl-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 8-chloro-3-(4-chloro-2,5-difluorophenyl)-5,6-dimethyl-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 82771182 |
| Molecular Formula | C13H8Cl2F2N4 |
| Molecular Weight | 329.14 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | 8-chloro-3-(4-chloro-2,5-difluorophenyl)-5,6-dimethyl-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | Cc1nc(Cl)c2nnc(-c3cc(F)c(Cl)cc3F)n2c1C |
| InChI | InChI=1S/C13H8Cl2F2N4/c1-5-6(2)21-12(19-20-13(21)11(15)18-5)7-3-10(17)8(14)4-9(7)16/h3-4H,1-2H3 |
| InChIKey | RFRNKENNBUMKJY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.14 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|