C12H11F2NOS — CID 116867625
1-[4-(2,5-difluorophenyl)-5-methyl-1,3-thiazol-2-yl]ethanol (PubChem CID 116867625) has the molecular formula C12H11F2NOS and a molecular weight of 255.29 g/mol. Its IUPAC name is 1-[4-(2,5-difluorophenyl)-5-methyl-1,3-thiazol-2-yl]ethanol.
| Compound Name | 1-[4-(2,5-difluorophenyl)-5-methyl-1,3-thiazol-2-yl]ethanol |
|---|---|
| PubChem CID | 116867625 |
| Molecular Formula | C12H11F2NOS |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | 1-[4-(2,5-difluorophenyl)-5-methyl-1,3-thiazol-2-yl]ethanol |
| SMILES | Cc1sc(C(C)O)nc1-c1cc(F)ccc1F |
| InChI | InChI=1S/C12H11F2NOS/c1-6(16)12-15-11(7(2)17-12)9-5-8(13)3-4-10(9)14/h3-6,16H,1-2H3 |
| InChIKey | QHEKJJWCOWJVQX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |