C9H7F2N3S — CID 82342230
4-(2,5-difluorophenyl)-1,3-thiazole-2,5-diamine (PubChem CID 82342230) has the molecular formula C9H7F2N3S and a molecular weight of 227.24 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)-1,3-thiazole-2,5-diamine.
| Compound Name | 4-(2,5-difluorophenyl)-1,3-thiazole-2,5-diamine |
|---|---|
| PubChem CID | 82342230 |
| Molecular Formula | C9H7F2N3S |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 4-(2,5-difluorophenyl)-1,3-thiazole-2,5-diamine |
| SMILES | Nc1nc(-c2cc(F)ccc2F)c(N)s1 |
| InChI | InChI=1S/C9H7F2N3S/c10-4-1-2-6(11)5(3-4)7-8(12)15-9(13)14-7/h1-3H,12H2,(H2,13,14) |
| InChIKey | KGXIJSXYTXFSHC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |