C14H12Cl2F2N2 — CID 102753304
3,5-dichloro-6-(2,5-difluorophenyl)-N-propylpyridin-2-amine (PubChem CID 102753304) has the molecular formula C14H12Cl2F2N2 and a molecular weight of 317.17 g/mol. Its IUPAC name is 3,5-dichloro-6-(2,5-difluorophenyl)-N-propylpyridin-2-amine.
| Compound Name | 3,5-dichloro-6-(2,5-difluorophenyl)-N-propylpyridin-2-amine |
|---|---|
| PubChem CID | 102753304 |
| Molecular Formula | C14H12Cl2F2N2 |
| Molecular Weight | 317.17 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 3,5-dichloro-6-(2,5-difluorophenyl)-N-propylpyridin-2-amine |
| SMILES | CCCNc1nc(-c2cc(F)ccc2F)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H12Cl2F2N2/c1-2-5-19-14-11(16)7-10(15)13(20-14)9-6-8(17)3-4-12(9)18/h3-4,6-7H,2,5H2,1H3,(H,19,20) |
| InChIKey | WRGWDAMQNISSCR-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.17 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |