C14H11Cl2F3N2 — CID 102753760
3,5-dichloro-N-propyl-6-(2,4,5-trifluorophenyl)pyridin-2-amine (PubChem CID 102753760) has the molecular formula C14H11Cl2F3N2 and a molecular weight of 335.16 g/mol. Its IUPAC name is 3,5-dichloro-N-propyl-6-(2,4,5-trifluorophenyl)pyridin-2-amine.
| Compound Name | 3,5-dichloro-N-propyl-6-(2,4,5-trifluorophenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102753760 |
| Molecular Formula | C14H11Cl2F3N2 |
| Molecular Weight | 335.16 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 3,5-dichloro-N-propyl-6-(2,4,5-trifluorophenyl)pyridin-2-amine |
| SMILES | CCCNc1nc(-c2cc(F)c(F)cc2F)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H11Cl2F3N2/c1-2-3-20-14-9(16)5-8(15)13(21-14)7-4-11(18)12(19)6-10(7)17/h4-6H,2-3H2,1H3,(H,20,21) |
| InChIKey | OBGTYYFFAJIQHW-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.16 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|