C15H12Cl2FN3 — CID 102753566
3-[3,5-dichloro-6-(propylamino)-2-pyridinyl]-5-fluorobenzonitrile (PubChem CID 102753566) has the molecular formula C15H12Cl2FN3 and a molecular weight of 324.19 g/mol. Its IUPAC name is 3-[3,5-dichloro-6-(propylamino)-2-pyridinyl]-5-fluorobenzonitrile.
| Compound Name | 3-[3,5-dichloro-6-(propylamino)-2-pyridinyl]-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 102753566 |
| Molecular Formula | C15H12Cl2FN3 |
| Molecular Weight | 324.19 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 3-[3,5-dichloro-6-(propylamino)-2-pyridinyl]-5-fluorobenzonitrile |
| SMILES | CCCNc1nc(-c2cc(F)cc(C#N)c2)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H12Cl2FN3/c1-2-3-20-15-13(17)7-12(16)14(21-15)10-4-9(8-19)5-11(18)6-10/h4-7H,2-3H2,1H3,(H,20,21) |
| InChIKey | NZVRIITYMZAHNK-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.19 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |