C14H13Cl2FIN3 — CID 102758994
3,5-dichloro-6-N-(4-fluoro-2-iodophenyl)-2-N-propylpyridine-2,6-diamine (PubChem CID 102758994) has the molecular formula C14H13Cl2FIN3 and a molecular weight of 440.09 g/mol. Its IUPAC name is 3,5-dichloro-6-N-(4-fluoro-2-iodophenyl)-2-N-propylpyridine-2,6-diamine.
| Compound Name | 3,5-dichloro-6-N-(4-fluoro-2-iodophenyl)-2-N-propylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 102758994 |
| Molecular Formula | C14H13Cl2FIN3 |
| Molecular Weight | 440.09 g/mol |
| Exact Mass | 438.95 |
| IUPAC Name | 3,5-dichloro-6-N-(4-fluoro-2-iodophenyl)-2-N-propylpyridine-2,6-diamine |
| SMILES | CCCNc1nc(Nc2ccc(F)cc2I)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H13Cl2FIN3/c1-2-5-19-13-9(15)7-10(16)14(21-13)20-12-4-3-8(17)6-11(12)18/h3-4,6-7H,2,5H2,1H3,(H2,19,20,21) |
| InChIKey | LUZJFUORWCLFAJ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.09 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|