C14H15FIN3 — CID 104535267
5-N-(4-fluoro-2-iodophenyl)-3-N-propylpyridine-3,5-diamine (PubChem CID 104535267) has the molecular formula C14H15FIN3 and a molecular weight of 371.20 g/mol. Its IUPAC name is 5-N-(4-fluoro-2-iodophenyl)-3-N-propylpyridine-3,5-diamine.
| Compound Name | 5-N-(4-fluoro-2-iodophenyl)-3-N-propylpyridine-3,5-diamine |
|---|---|
| PubChem CID | 104535267 |
| Molecular Formula | C14H15FIN3 |
| Molecular Weight | 371.20 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | 5-N-(4-fluoro-2-iodophenyl)-3-N-propylpyridine-3,5-diamine |
| SMILES | CCCNc1cncc(Nc2ccc(F)cc2I)c1 |
| InChI | InChI=1S/C14H15FIN3/c1-2-5-18-11-7-12(9-17-8-11)19-14-4-3-10(15)6-13(14)16/h3-4,6-9,18-19H,2,5H2,1H3 |
| InChIKey | XXPAKHYORLFHCH-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.20 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|