C15H18FN3 — CID 104532100
5-N-(2-fluoro-5-methylphenyl)-3-N-propylpyridine-3,5-diamine (PubChem CID 104532100) has the molecular formula C15H18FN3 and a molecular weight of 259.33 g/mol. Its IUPAC name is 5-N-(2-fluoro-5-methylphenyl)-3-N-propylpyridine-3,5-diamine.
| Compound Name | 5-N-(2-fluoro-5-methylphenyl)-3-N-propylpyridine-3,5-diamine |
|---|---|
| PubChem CID | 104532100 |
| Molecular Formula | C15H18FN3 |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | 5-N-(2-fluoro-5-methylphenyl)-3-N-propylpyridine-3,5-diamine |
| SMILES | CCCNc1cncc(Nc2cc(C)ccc2F)c1 |
| InChI | InChI=1S/C15H18FN3/c1-3-6-18-12-8-13(10-17-9-12)19-15-7-11(2)4-5-14(15)16/h4-5,7-10,18-19H,3,6H2,1-2H3 |
| InChIKey | LQOCIFADHZRVLD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |