C15H19N3S — CID 104532143
5-N-(4-methylsulfanylphenyl)-3-N-propylpyridine-3,5-diamine (PubChem CID 104532143) has the molecular formula C15H19N3S and a molecular weight of 273.41 g/mol. Its IUPAC name is 5-N-(4-methylsulfanylphenyl)-3-N-propylpyridine-3,5-diamine.
| Compound Name | 5-N-(4-methylsulfanylphenyl)-3-N-propylpyridine-3,5-diamine |
|---|---|
| PubChem CID | 104532143 |
| Molecular Formula | C15H19N3S |
| Molecular Weight | 273.41 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 5-N-(4-methylsulfanylphenyl)-3-N-propylpyridine-3,5-diamine |
| SMILES | CCCNc1cncc(Nc2ccc(SC)cc2)c1 |
| InChI | InChI=1S/C15H19N3S/c1-3-8-17-13-9-14(11-16-10-13)18-12-4-6-15(19-2)7-5-12/h4-7,9-11,17-18H,3,8H2,1-2H3 |
| InChIKey | PRWGZHVGJJIZTA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |