C16H21N3 — CID 104532378
5-N-(3,5-dimethylphenyl)-3-N-propylpyridine-3,5-diamine (PubChem CID 104532378) has the molecular formula C16H21N3 and a molecular weight of 255.37 g/mol. Its IUPAC name is 5-N-(3,5-dimethylphenyl)-3-N-propylpyridine-3,5-diamine.
| Compound Name | 5-N-(3,5-dimethylphenyl)-3-N-propylpyridine-3,5-diamine |
|---|---|
| PubChem CID | 104532378 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 5-N-(3,5-dimethylphenyl)-3-N-propylpyridine-3,5-diamine |
| SMILES | CCCNc1cncc(Nc2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C16H21N3/c1-4-5-18-15-9-16(11-17-10-15)19-14-7-12(2)6-13(3)8-14/h6-11,18-19H,4-5H2,1-3H3 |
| InChIKey | ZQGSKBMQAZRKFN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |