C15H19N3O2S — CID 104532326
5-N-(4-methylsulfonylphenyl)-3-N-propylpyridine-3,5-diamine (PubChem CID 104532326) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 5-N-(4-methylsulfonylphenyl)-3-N-propylpyridine-3,5-diamine.
| Compound Name | 5-N-(4-methylsulfonylphenyl)-3-N-propylpyridine-3,5-diamine |
|---|---|
| PubChem CID | 104532326 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 5-N-(4-methylsulfonylphenyl)-3-N-propylpyridine-3,5-diamine |
| SMILES | CCCNc1cncc(Nc2ccc(S(C)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C15H19N3O2S/c1-3-8-17-13-9-14(11-16-10-13)18-12-4-6-15(7-5-12)21(2,19)20/h4-7,9-11,17-18H,3,8H2,1-2H3 |
| InChIKey | WFODUWJQCZJDHZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |